Products 16760-45-5
CAS 16760-45-5 is the registry number for 13-cis Retinoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 5mg.
Methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (CAS 16760-45-5) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 314.5 g/mol. IUPAC name: methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate. InChIKey: SREQLAJQLXPNMC-WYSPNRNQSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| InChIKey | SREQLAJQLXPNMC-WYSPNRNQSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C\C(=O)OC)/C)/C |
Computed by PubChem (NCBI)