Products 16766-29-3
CAS 16766-29-3 is the registry number for 3,4,5-Trichloroveratrole. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,2,3-trichloro-4,5-dimethoxybenzene (CAS 16766-29-3) is a chemical compound with the molecular formula C8H7Cl3O2 and a molecular weight of 241.5 g/mol. IUPAC name: 1,2,3-trichloro-4,5-dimethoxybenzene. InChIKey: VKNITLPENCJQOP-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3O2 |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | 1,2,3-trichloro-4,5-dimethoxybenzene |
| InChIKey | VKNITLPENCJQOP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1OC)Cl)Cl)Cl |
Computed by PubChem (NCBI)