CAS 167707-00-8 is the registry number for 1-Bromodithieno[2,3-b:3',4'-d]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4,10-dithia-8-azatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,11-pentaene (CAS 167707-00-8) is a chemical compound with the molecular formula C9H4BrNS2 and a molecular weight of 270.2 g/mol. IUPAC name: 3-bromo-4,10-dithia-8-azatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,11-pentaene. InChIKey: JAVBFTJFYTUKKL-UHFFFAOYSA-N.
| Molecular formula | C9H4BrNS2 |
|---|---|
| Molecular weight | 270.2 g/mol |
| IUPAC name | 3-bromo-4,10-dithia-8-azatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,11-pentaene |
| InChIKey | JAVBFTJFYTUKKL-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C3=C(SC=C3C=N2)Br |
Computed by PubChem (NCBI)