CAS 887573-17-3 is the registry number for 8-Bromodithieno[3,2-b:3',2'-d]pyridine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
12-bromo-3,10-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (CAS 887573-17-3) is a chemical compound with the molecular formula C9H4BrNS2 and a molecular weight of 270.2 g/mol. IUPAC name: 12-bromo-3,10-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene. InChIKey: FWAGXUJPZLNNEM-UHFFFAOYSA-N.
| Molecular formula | C9H4BrNS2 |
|---|---|
| Molecular weight | 270.2 g/mol |
| IUPAC name | 12-bromo-3,10-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| InChIKey | FWAGXUJPZLNNEM-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C3C(=CN=C21)SC=C3Br |
Computed by PubChem (NCBI)