CAS 1679365-44-6 appears in our catalog under these names: 2,8-Di-tert-butyl-5,11-dihydroindolo(3,2-b)carbazole, 95%, 2,8-Di-tert-butyl-5,11-dihydroindolo[3,2-b]carbazole, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 25g, 10g.
2,8-ditert-butyl-5,11-dihydroindolo[3,2-b]carbazole (CAS 1679365-44-6) is a chemical compound with the molecular formula C26H28N2 and a molecular weight of 368.5 g/mol. IUPAC name: 2,8-ditert-butyl-5,11-dihydroindolo[3,2-b]carbazole. InChIKey: BTTIFBWUDPWYIA-UHFFFAOYSA-N.
| Molecular formula | C26H28N2 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | 2,8-ditert-butyl-5,11-dihydroindolo[3,2-b]carbazole |
| InChIKey | BTTIFBWUDPWYIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NC3=CC4=C(C=C32)NC5=C4C=C(C=C5)C(C)(C)C |
Computed by PubChem (NCBI)