CAS 2455469-18-6 is the registry number for AW4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(1R,2S)-2-[4-(3-phenylphenyl)phenyl]cyclopropyl]piperidin-4-amine (CAS 2455469-18-6) is a chemical compound with the molecular formula C26H28N2 and a molecular weight of 368.5 g/mol. IUPAC name: N-[(1R,2S)-2-[4-(3-phenylphenyl)phenyl]cyclopropyl]piperidin-4-amine. InChIKey: ZPRBYRSXROQFNL-IZZNHLLZSA-N.
| Molecular formula | C26H28N2 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | N-[(1R,2S)-2-[4-(3-phenylphenyl)phenyl]cyclopropyl]piperidin-4-amine |
| InChIKey | ZPRBYRSXROQFNL-IZZNHLLZSA-N |
| SMILES | C1CNCCC1N[C@@H]2C[C@H]2C3=CC=C(C=C3)C4=CC=CC(=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)