CAS 167995-29-1 is the registry number for Acetic acid, (4-chloro-3,5-dimethylphenoxy)-, ethyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Ethyl 2-(4-chloro-3,5-dimethylphenoxy)acetate (CAS 167995-29-1) is a chemical compound with the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. IUPAC name: ethyl 2-(4-chloro-3,5-dimethylphenoxy)acetate. InChIKey: BYHLSWXJCVEMBA-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO3 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | ethyl 2-(4-chloro-3,5-dimethylphenoxy)acetate |
| InChIKey | BYHLSWXJCVEMBA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=CC(=C(C(=C1)C)Cl)C |
Computed by PubChem (NCBI)