CAS 168003-69-8 is the registry number for 3,8-Bis(phenylethynyl)-1,10-phenanthroline, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
3,8-bis(2-phenylethynyl)-1,10-phenanthroline (CAS 168003-69-8) is a chemical compound with the molecular formula C28H16N2 and a molecular weight of 380.4 g/mol. IUPAC name: 3,8-bis(2-phenylethynyl)-1,10-phenanthroline. InChIKey: MHEPBSUIVOVLKV-UHFFFAOYSA-N.
| Molecular formula | C28H16N2 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 3,8-bis(2-phenylethynyl)-1,10-phenanthroline |
| InChIKey | MHEPBSUIVOVLKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CN=C3C(=C2)C=CC4=CC(=CN=C43)C#CC5=CC=CC=C5 |
Computed by PubChem (NCBI)