CAS 99372-96-0 is the registry number for 4,4'-(Anthracene-9,10-diyl)dibenzonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[10-(4-cyanophenyl)anthracen-9-yl]benzonitrile (CAS 99372-96-0) is a chemical compound with the molecular formula C28H16N2 and a molecular weight of 380.4 g/mol. IUPAC name: 4-[10-(4-cyanophenyl)anthracen-9-yl]benzonitrile. InChIKey: DSPGMQPXTWKKKG-UHFFFAOYSA-N.
| Molecular formula | C28H16N2 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 4-[10-(4-cyanophenyl)anthracen-9-yl]benzonitrile |
| InChIKey | DSPGMQPXTWKKKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC=C(C=C4)C#N)C5=CC=C(C=C5)C#N |
Computed by PubChem (NCBI)