Products 1680179-43-4
CAS 1680179-43-4 appears in our catalog under these names: TrkA–IN–1, Trka-in-1, TrkA-IN-1, 96.46%, TrkA-IN-1, 98.03%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 25mg, 10 mg, 5 mg.
1-(9H-fluoren-9-yl)-3-(2-methyl-4-phenylpyrimidin-5-yl)urea (CAS 1680179-43-4) is a chemical compound with the molecular formula C25H20N4O and a molecular weight of 392.5 g/mol. IUPAC name: 1-(9H-fluoren-9-yl)-3-(2-methyl-4-phenylpyrimidin-5-yl)urea. InChIKey: PKOROKYRNIDSPX-UHFFFAOYSA-N.
| Molecular formula | C25H20N4O |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 1-(9H-fluoren-9-yl)-3-(2-methyl-4-phenylpyrimidin-5-yl)urea |
| InChIKey | PKOROKYRNIDSPX-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=N1)C2=CC=CC=C2)NC(=O)NC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)