Products 2125486-34-0
CAS 2125486-34-0 appears in our catalog under these names: pyCTZ, pyCTZ, 95.82%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 5 mg, 100 mg, 25 mg, 50 mg.
8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (CAS 2125486-34-0) is a chemical compound with the molecular formula C25H20N4O and a molecular weight of 392.5 g/mol. IUPAC name: 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)imidazo[1,2-a]pyrazin-3-ol. InChIKey: UDIRTQQHORMUSF-UHFFFAOYSA-N.
| Molecular formula | C25H20N4O |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| InChIKey | UDIRTQQHORMUSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CN3C2=NC(=C3O)CC4=CC=NC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)