Products 1680184-59-1
CAS 1680184-59-1 appears in our catalog under these names: Afatinib Impurity M, Afatinib Impurity B (2Z)-Afatinib, Afatinib Impurity D (Z-Afatinib), (2Z)-Afatinib, (2Z)–Afatinib. Offered by: Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: on request, 0,5mg, 1mg, 2,5mg, 2mg.
(Z)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide (CAS 1680184-59-1) is a chemical compound with the molecular formula C24H25ClFN5O3 and a molecular weight of 485.9 g/mol. IUPAC name: (Z)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide. InChIKey: ULXXDDBFHOBEHA-QGZUEGPWSA-N.
| Molecular formula | C24H25ClFN5O3 |
|---|---|
| Molecular weight | 485.9 g/mol |
| IUPAC name | (Z)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| InChIKey | ULXXDDBFHOBEHA-QGZUEGPWSA-N |
| SMILES | CN(C)C/C=C\C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)O[C@H]4CCOC4 |
Computed by PubChem (NCBI)