Products 945553-91-3
CAS 945553-91-3 appears in our catalog under these names: Afatinib impurity 3, 99.55%, Afatinib impurity c, 98%, Afatinib Impurity 70, Afatinib Impurity C, (R)-Afatinib, >95% (HPLC). Offered by: MedChemExpress, Combi-blocks, Chemat Brand, TRC. Available pack sizes: 10 mg, 25 mg, 5 mg, 250mg, 100mg, 1g, on request, 10mg.
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide (CAS 945553-91-3) is a chemical compound with the molecular formula C24H25ClFN5O3 and a molecular weight of 485.9 g/mol. IUPAC name: (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide. InChIKey: ULXXDDBFHOBEHA-QDLOVBKTSA-N.
| Molecular formula | C24H25ClFN5O3 |
|---|---|
| Molecular weight | 485.9 g/mol |
| IUPAC name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| InChIKey | ULXXDDBFHOBEHA-QDLOVBKTSA-N |
| SMILES | CN(C)C/C=C/C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)O[C@@H]4CCOC4 |
Computed by PubChem (NCBI)