CAS 168265-57-4 appears in our catalog under these names: N-t-Butyl 2-bromobenzamide, 98%, 2-Bromo-N-(tert-butyl)benzamide, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
2-bromo-N-tert-butylbenzamide (CAS 168265-57-4) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 2-bromo-N-tert-butylbenzamide. InChIKey: TVNDQPPEFATMSD-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 2-bromo-N-tert-butylbenzamide |
| InChIKey | TVNDQPPEFATMSD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)