CAS 168297-77-6 is the registry number for (S)-1-Amino-2-methyl-1-phenyl-propan-2-ol hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(1S)-1-amino-2-methyl-1-phenylpropan-2-ol;hydrochloride (CAS 168297-77-6) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (1S)-1-amino-2-methyl-1-phenylpropan-2-ol;hydrochloride. InChIKey: KXLBTDXBYUFQJM-FVGYRXGTSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (1S)-1-amino-2-methyl-1-phenylpropan-2-ol;hydrochloride |
| InChIKey | KXLBTDXBYUFQJM-FVGYRXGTSA-N |
| SMILES | CC(C)([C@H](C1=CC=CC=C1)N)O.Cl |
Computed by PubChem (NCBI)