CAS 873893-95-9 appears in our catalog under these names: (1S)-1-(2-Methoxyphenyl)propylamine hydrochloride, 95%, (S)-1-(2-Methoxyphenyl)propan-1-amine hydrochloride, 95+%, (1S)-1-(2-METHOXYPHENYL)PROPYLAMINE-HCl, 97%, 97%, (1S)-1-(2-Methoxyphenyl)propylamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(1S)-1-(2-methoxyphenyl)propan-1-amine;hydrochloride (CAS 873893-95-9) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (1S)-1-(2-methoxyphenyl)propan-1-amine;hydrochloride. InChIKey: XPWHPGHAPKCHQY-FVGYRXGTSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (1S)-1-(2-methoxyphenyl)propan-1-amine;hydrochloride |
| InChIKey | XPWHPGHAPKCHQY-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=CC=CC=C1OC)N.Cl |
Computed by PubChem (NCBI)