CAS 16832-24-9 appears in our catalog under these names: H-His(Bzl)-OH, 95%, H-His(Bzl)-OH 97%, 1-(Phenylmethyl)-L-histidine, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g.
(2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid (CAS 16832-24-9) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid. InChIKey: NMXSWQMJOZUQKY-LBPRGKRZSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid |
| InChIKey | NMXSWQMJOZUQKY-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)