Products 16832-58-9
CAS 16832-58-9 is the registry number for 2,2′-(1,4-Phenylene)bis[oxirane], 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
2-[4-(oxiran-2-yl)phenyl]oxirane (CAS 16832-58-9) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: 2-[4-(oxiran-2-yl)phenyl]oxirane. InChIKey: GXZQKSKXXFOTDE-UHFFFAOYSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | 2-[4-(oxiran-2-yl)phenyl]oxirane |
| InChIKey | GXZQKSKXXFOTDE-UHFFFAOYSA-N |
| SMILES | C1C(O1)C2=CC=C(C=C2)C3CO3 |
Computed by PubChem (NCBI)
Synonyms:
p-Bis(epoxyethyl)benzene, Oxirane, 2,2'-(1,4-phenylene)bis-, Oxirane, 2,2'-(phenylene)bis-, BIS(EPOXYETHYL)BENZENE, P-, BENZENE, P-BIS(EPOXYETHYL)-, 1,4-Di(oxiran-2-yl)benzene, 2-[4-(oxiran-2-yl)phenyl]oxirane, 2,2'-(1,4-Phenylene)bis[oxirane], GXZQKSKXXFOTDE-UHFFFAOYSA-N, 2,2 inverted exclamation marka-(1,4-Phenylene)bis[oxirane]