CAS 168329-48-4 appears in our catalog under these names: Brimonidine EP Impurity E, 1-(5-Bromoquinoxalin-6-yl)guanidine, 95%, 95%, Brimonidine impurity 2. Offered by: Chemat Brand, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, Get quote.
2-(5-bromoquinoxalin-6-yl)guanidine (CAS 168329-48-4) is a chemical compound with the molecular formula C9H8BrN5 and a molecular weight of 266.10 g/mol. IUPAC name: 2-(5-bromoquinoxalin-6-yl)guanidine. InChIKey: WBGSURPVIDDDHF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN5 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | 2-(5-bromoquinoxalin-6-yl)guanidine |
| InChIKey | WBGSURPVIDDDHF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN=C2C(=C1N=C(N)N)Br |
Computed by PubChem (NCBI)