CAS 72274-25-0 is the registry number for N2-(4-Bromophenyl)-1,3,5-triazine-2,4-diamine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-N-(4-bromophenyl)-1,3,5-triazine-2,4-diamine (CAS 72274-25-0) is a chemical compound with the molecular formula C9H8BrN5 and a molecular weight of 266.10 g/mol. IUPAC name: 2-N-(4-bromophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: UBVSIAHUTXHQTD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN5 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | 2-N-(4-bromophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | UBVSIAHUTXHQTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC=NC(=N2)N)Br |
Computed by PubChem (NCBI)