CAS 168471-40-7 appears in our catalog under these names: (1R,4S)–rel–4–Aminocyclopent–2–enecarboxylic acid, (1S,4R)-4-Amino-2-cyclopenten-1-carboxylic Acid 95%, (1R,4S)-rel-4-Aminocyclopent-2-enecarboxylic acid, 95%, 95%, rel-(1R,4S)-4-Amino-2-cyclopentene-1-carboxylic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1S,4R)-4-aminocyclopent-2-ene-1-carboxylic acid (CAS 168471-40-7) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (1S,4R)-4-aminocyclopent-2-ene-1-carboxylic acid. InChIKey: VTCHZFWYUPZZKL-UHNVWZDZSA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 127.14 g/mol |
| IUPAC name | (1S,4R)-4-aminocyclopent-2-ene-1-carboxylic acid |
| InChIKey | VTCHZFWYUPZZKL-UHNVWZDZSA-N |
| SMILES | C1[C@@H](C=C[C@@H]1N)C(=O)O |
Computed by PubChem (NCBI)