Products 1685-18-3
CAS 1685-18-3 is the registry number for 1-(2-Amino-5-chlorophenyl)-1-pentanone. Offered by: Biosynth. Available pack sizes: 1g, 0,25g.
1-(2-amino-5-chlorophenyl)pentan-1-one (CAS 1685-18-3) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 1-(2-amino-5-chlorophenyl)pentan-1-one. InChIKey: OOLZPYIAYOACFI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 1-(2-amino-5-chlorophenyl)pentan-1-one |
| InChIKey | OOLZPYIAYOACFI-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)C1=C(C=CC(=C1)Cl)N |
Computed by PubChem (NCBI)