Products 1686098-07-6

CAS 1686098-07-6 is the registry number for B-[4-([1,1′-Biphenyl]-3-yl[1,1′-biphenyl]-4-ylamino)phenyl]boronic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]boronic acid (CAS 1686098-07-6) is a chemical compound with the molecular formula C30H24BNO2 and a molecular weight of 441.3 g/mol. IUPAC name: [4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]boronic acid. InChIKey: IBDYKUDDRNMKBD-UHFFFAOYSA-N.

Identity
Molecular formulaC30H24BNO2
Molecular weight441.3 g/mol
IUPAC name[4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]boronic acid
InChIKeyIBDYKUDDRNMKBD-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=CC=C3)C4=CC=CC(=C4)C5=CC=CC=C5)(O)O

Computed by PubChem (NCBI)