CAS 1686098-07-6 is the registry number for B-[4-([1,1′-Biphenyl]-3-yl[1,1′-biphenyl]-4-ylamino)phenyl]boronic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]boronic acid (CAS 1686098-07-6) is a chemical compound with the molecular formula C30H24BNO2 and a molecular weight of 441.3 g/mol. IUPAC name: [4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]boronic acid. InChIKey: IBDYKUDDRNMKBD-UHFFFAOYSA-N.
| Molecular formula | C30H24BNO2 |
|---|---|
| Molecular weight | 441.3 g/mol |
| IUPAC name | [4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]boronic acid |
| InChIKey | IBDYKUDDRNMKBD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=CC=C3)C4=CC=CC(=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)