CAS 943836-24-6 appears in our catalog under these names: 4-(dibiphenyl-4-ylamino)phenylboronic acid4-(dibiphenyl-4-ylamino)phenylboronic acid, >98%, (4–(Di((1,1'–biphenyl)–4–yl)amino)phenyl)boronic acid, (4-(Di([1,1'-biphenyl]-4-yl)amino)phenyl)boronic acid, 97%, 97%, (4-(Di([1,1'-biphenyl]-4-yl)amino)phenyl)boronic acid, 97%. Offered by: Lumtec, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: On request, 1g, 250mg, 5g, 100mg.
[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]boronic acid (CAS 943836-24-6) is a chemical compound with the molecular formula C30H24BNO2 and a molecular weight of 441.3 g/mol. IUPAC name: [4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]boronic acid. InChIKey: BEBLXYZXQGRFKD-UHFFFAOYSA-N.
| Molecular formula | C30H24BNO2 |
|---|---|
| Molecular weight | 441.3 g/mol |
| IUPAC name | [4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]boronic acid |
| InChIKey | BEBLXYZXQGRFKD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=CC=C3)C4=CC=C(C=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)