CAS 168610-12-6 is the registry number for tert-Butyl (2R,6S)-2-(hydroxymethyl)-6-methylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,6S)-2-(hydroxymethyl)-6-methylpiperidine-1-carboxylate (CAS 168610-12-6) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl (2R,6S)-2-(hydroxymethyl)-6-methylpiperidine-1-carboxylate. InChIKey: QRQKEEFTQDHHHT-VHSXEESVSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl (2R,6S)-2-(hydroxymethyl)-6-methylpiperidine-1-carboxylate |
| InChIKey | QRQKEEFTQDHHHT-VHSXEESVSA-N |
| SMILES | C[C@H]1CCC[C@@H](N1C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)