CAS 16874-12-7 appears in our catalog under these names: H–Tyr–OtBu, H-L-Tyr-OtBu, L-Tyrosine tert-butyl ester, 98.00%, L-Tyrosine tert-Butyl Ester, >97.0%(HPLC)(T), H-Tyr-OtBu, 98%, 98%. Offered by: GLPBio, Iris Biotech, Chemat, TCI, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 10g, 250mg, 1g, 25 g, 10 g.
Tert-butyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (CAS 16874-12-7) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate. InChIKey: DIGHFXIWRPMGSA-NSHDSACASA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| InChIKey | DIGHFXIWRPMGSA-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)