CAS 87553-74-0 appears in our catalog under these names: H–D–Tyr–OtBu, D-Tyrosine tert-butyl ester, 98% , H-D-Tyr-OtBu, 97%, 97%, h-d-tyr-otbu, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
Tert-butyl 2-amino-3-(4-hydroxyphenyl)propanoate (CAS 87553-74-0) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: tert-butyl 2-amino-3-(4-hydroxyphenyl)propanoate. InChIKey: DIGHFXIWRPMGSA-UHFFFAOYSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | tert-butyl 2-amino-3-(4-hydroxyphenyl)propanoate |
| InChIKey | DIGHFXIWRPMGSA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(CC1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)