CAS 168828-75-9 is the registry number for 4-(2,6-Difluoro-4-nitrophenyl)morpholine, 98%. Offered by: AmBeed. Available pack sizes: 10g.
4-(2,6-difluoro-4-nitrophenyl)morpholine (CAS 168828-75-9) is a chemical compound with the molecular formula C10H10F2N2O3 and a molecular weight of 244.19 g/mol. IUPAC name: 4-(2,6-difluoro-4-nitrophenyl)morpholine. InChIKey: ULZHNLWXQZVHLN-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2O3 |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | 4-(2,6-difluoro-4-nitrophenyl)morpholine |
| InChIKey | ULZHNLWXQZVHLN-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)