CAS 170432-55-0 appears in our catalog under these names: 4-(2,3-Difluoro-6-nitrophenyl)morpholine, 95%, 4-(2,3-Difluoro-6-nitrophenyl)morpholine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(2,3-difluoro-6-nitrophenyl)morpholine (CAS 170432-55-0) is a chemical compound with the molecular formula C10H10F2N2O3 and a molecular weight of 244.19 g/mol. IUPAC name: 4-(2,3-difluoro-6-nitrophenyl)morpholine. InChIKey: XVOGVXCGIQDLOD-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2O3 |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | 4-(2,3-difluoro-6-nitrophenyl)morpholine |
| InChIKey | XVOGVXCGIQDLOD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=CC(=C2F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)