CAS 168849-77-2 appears in our catalog under these names: 4'-Bromo-2,6-dimethoxy-1,1'-biphenyl, 95%, 4'-Bromo-2,6-dimethoxy-1,1'-biphenyl, 97%, 4'-Bromo-2,6-dimethoxy-1,1'-biphenyl, ≥95%, ≥95%, 4'-Bromo-2,6-dimethoxy-1,1'-biphenyl, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
2-(4-bromophenyl)-1,3-dimethoxybenzene (CAS 168849-77-2) is a chemical compound with the molecular formula C14H13BrO2 and a molecular weight of 293.15 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-dimethoxybenzene. InChIKey: NXWPUEAMHLXATE-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO2 |
|---|---|
| Molecular weight | 293.15 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-dimethoxybenzene |
| InChIKey | NXWPUEAMHLXATE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)