CAS 177759-46-5 appears in our catalog under these names: 2-Benzylox-5-bromobenzyl alcohol, 98%, (2-(Benzyloxy)-5-bromophenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
(5-bromo-2-phenylmethoxyphenyl)methanol (CAS 177759-46-5) is a chemical compound with the molecular formula C14H13BrO2 and a molecular weight of 293.15 g/mol. IUPAC name: (5-bromo-2-phenylmethoxyphenyl)methanol. InChIKey: AIDBRISXEJMHLS-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO2 |
|---|---|
| Molecular weight | 293.15 g/mol |
| IUPAC name | (5-bromo-2-phenylmethoxyphenyl)methanol |
| InChIKey | AIDBRISXEJMHLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Br)CO |
Computed by PubChem (NCBI)