Products 168980-09-4
CAS 168980-09-4 is the registry number for (2S)-2-(Cyclopentylformamido)-4-methylpentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-2-(cyclopentanecarbonylamino)-4-methylpentanoic acid (CAS 168980-09-4) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: (2S)-2-(cyclopentanecarbonylamino)-4-methylpentanoic acid. InChIKey: CUPRCYCQEIRPTA-JTQLQIEISA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (2S)-2-(cyclopentanecarbonylamino)-4-methylpentanoic acid |
| InChIKey | CUPRCYCQEIRPTA-JTQLQIEISA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)C1CCCC1 |
Computed by PubChem (NCBI)