CAS 168985-95-3 is the registry number for 2,3-Dimethoxy-1-tert-butyl-phenyl-5-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3-tert-butyl-4,5-dimethoxyphenyl)boronic acid (CAS 168985-95-3) is a chemical compound with the molecular formula C12H19BO4 and a molecular weight of 238.09 g/mol. IUPAC name: (3-tert-butyl-4,5-dimethoxyphenyl)boronic acid. InChIKey: IVJXKJAHMOTLGX-UHFFFAOYSA-N.
| Molecular formula | C12H19BO4 |
|---|---|
| Molecular weight | 238.09 g/mol |
| IUPAC name | (3-tert-butyl-4,5-dimethoxyphenyl)boronic acid |
| InChIKey | IVJXKJAHMOTLGX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OC)OC)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)