CAS 1690671-53-4 is the registry number for 2-((Oxetan-3-ylamino)methyl)furan-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(oxetan-3-ylamino)methyl]furan-3-carboxylic acid (CAS 1690671-53-4) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-[(oxetan-3-ylamino)methyl]furan-3-carboxylic acid. InChIKey: UZAQLDIUGBWMJH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-[(oxetan-3-ylamino)methyl]furan-3-carboxylic acid |
| InChIKey | UZAQLDIUGBWMJH-UHFFFAOYSA-N |
| SMILES | C1C(CO1)NCC2=C(C=CO2)C(=O)O |
Computed by PubChem (NCBI)