CAS 1691032-13-9 appears in our catalog under these names: 2-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)-3-(pyrimidin-4-yl)propanoic acid, 95%, 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3-(pyrimidin-4-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrimidin-4-ylpropanoic acid (CAS 1691032-13-9) is a chemical compound with the molecular formula C22H19N3O4 and a molecular weight of 389.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrimidin-4-ylpropanoic acid. InChIKey: XIIRNDKJGHFBNS-UHFFFAOYSA-N.
| Molecular formula | C22H19N3O4 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrimidin-4-ylpropanoic acid |
| InChIKey | XIIRNDKJGHFBNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=NC=NC=C4)C(=O)O |
Computed by PubChem (NCBI)