CAS 281655-47-8 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(pyrimidin-2-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrimidin-2-ylpropanoic acid (CAS 281655-47-8) is a chemical compound with the molecular formula C22H19N3O4 and a molecular weight of 389.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrimidin-2-ylpropanoic acid. InChIKey: ZYEBSBDLCHRWNS-IBGZPJMESA-N.
| Molecular formula | C22H19N3O4 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrimidin-2-ylpropanoic acid |
| InChIKey | ZYEBSBDLCHRWNS-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=NC=CC=N4)C(=O)O |
Computed by PubChem (NCBI)