CAS 169116-78-3 is the registry number for [(4,7-Dimethyl-2-oxo-2h-chromen-5-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetic acid (CAS 169116-78-3) is a chemical compound with the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. IUPAC name: 2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetic acid. InChIKey: KULJTNRHGAFYKM-UHFFFAOYSA-N.
| Molecular formula | C13H12O5 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetic acid |
| InChIKey | KULJTNRHGAFYKM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CC(=O)O2)C)C(=C1)OCC(=O)O |
Computed by PubChem (NCBI)