Products 169116-78-3

CAS 169116-78-3 is the registry number for [(4,7-Dimethyl-2-oxo-2h-chromen-5-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetic acid (CAS 169116-78-3) is a chemical compound with the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. IUPAC name: 2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetic acid. InChIKey: KULJTNRHGAFYKM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O5
Molecular weight248.23 g/mol
IUPAC name2-(4,7-dimethyl-2-oxochromen-5-yl)oxyacetic acid
InChIKeyKULJTNRHGAFYKM-UHFFFAOYSA-N
SMILESCC1=CC2=C(C(=CC(=O)O2)C)C(=C1)OCC(=O)O

Computed by PubChem (NCBI)