CAS 914203-21-7 appears in our catalog under these names: 7-Isopropoxy-2-oxo-2h-chromene-3-carboxylic acid, 95%, 7-Isopropoxy-2-oxo-2H-chromene-3-carboxylic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-oxo-7-propan-2-yloxychromene-3-carboxylic acid (CAS 914203-21-7) is a chemical compound with the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. IUPAC name: 2-oxo-7-propan-2-yloxychromene-3-carboxylic acid. InChIKey: IMPQYBJLUFVIKQ-UHFFFAOYSA-N.
| Molecular formula | C13H12O5 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 2-oxo-7-propan-2-yloxychromene-3-carboxylic acid |
| InChIKey | IMPQYBJLUFVIKQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)O |
Computed by PubChem (NCBI)