CAS 1691738-59-6 appears in our catalog under these names: (3,3-Difluorocyclopentyl)methanesulfonyl chloride, 95%, (3,3-Difluorocyclopentyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(3,3-difluorocyclopentyl)methanesulfonyl chloride (CAS 1691738-59-6) is a chemical compound with the molecular formula C6H9ClF2O2S and a molecular weight of 218.65 g/mol. IUPAC name: (3,3-difluorocyclopentyl)methanesulfonyl chloride. InChIKey: NEGGHEAQKMLFHJ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF2O2S |
|---|---|
| Molecular weight | 218.65 g/mol |
| IUPAC name | (3,3-difluorocyclopentyl)methanesulfonyl chloride |
| InChIKey | NEGGHEAQKMLFHJ-UHFFFAOYSA-N |
| SMILES | C1CC(CC1CS(=O)(=O)Cl)(F)F |
Computed by PubChem (NCBI)