Products 1691738-59-6

CAS 1691738-59-6 appears in our catalog under these names: (3,3-Difluorocyclopentyl)methanesulfonyl chloride, 95%, (3,3-Difluorocyclopentyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

(3,3-difluorocyclopentyl)methanesulfonyl chloride (CAS 1691738-59-6) is a chemical compound with the molecular formula C6H9ClF2O2S and a molecular weight of 218.65 g/mol. IUPAC name: (3,3-difluorocyclopentyl)methanesulfonyl chloride. InChIKey: NEGGHEAQKMLFHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClF2O2S
Molecular weight218.65 g/mol
IUPAC name(3,3-difluorocyclopentyl)methanesulfonyl chloride
InChIKeyNEGGHEAQKMLFHJ-UHFFFAOYSA-N
SMILESC1CC(CC1CS(=O)(=O)Cl)(F)F

Computed by PubChem (NCBI)