CAS 1785345-03-0 appears in our catalog under these names: (2,2-Difluorocyclopentyl)methanesulfonyl chloride, 95%, (2,2-Difluorocyclopentyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,2-difluorocyclopentyl)methanesulfonyl chloride (CAS 1785345-03-0) is a chemical compound with the molecular formula C6H9ClF2O2S and a molecular weight of 218.65 g/mol. IUPAC name: (2,2-difluorocyclopentyl)methanesulfonyl chloride. InChIKey: KKYOITPXDAHFAX-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF2O2S |
|---|---|
| Molecular weight | 218.65 g/mol |
| IUPAC name | (2,2-difluorocyclopentyl)methanesulfonyl chloride |
| InChIKey | KKYOITPXDAHFAX-UHFFFAOYSA-N |
| SMILES | C1CC(C(C1)(F)F)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)