CAS 169205-78-1 appears in our catalog under these names: N4-(3-Bromophenyl)quinazoline-4,6-diamine, 95%, N4-(3-Bromophenyl)quinazoline-4,6-diamine, >98.0%(HPLC). Offered by: Combi-blocks, TCI. Available pack sizes: 1g, 250mg, 25mg, 100mg.
4-N-(3-bromophenyl)quinazoline-4,6-diamine (CAS 169205-78-1) is a chemical compound with the molecular formula C14H11BrN4 and a molecular weight of 315.17 g/mol. IUPAC name: 4-N-(3-bromophenyl)quinazoline-4,6-diamine. InChIKey: IZQHULBHKPGOAP-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN4 |
|---|---|
| Molecular weight | 315.17 g/mol |
| IUPAC name | 4-N-(3-bromophenyl)quinazoline-4,6-diamine |
| InChIKey | IZQHULBHKPGOAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NC2=NC=NC3=C2C=C(C=C3)N |
Computed by PubChem (NCBI)