CAS 2378521-26-5 is the registry number for AS408, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-2-N-phenylquinazoline-2,4-diamine (CAS 2378521-26-5) is a chemical compound with the molecular formula C14H11BrN4 and a molecular weight of 315.17 g/mol. IUPAC name: 6-bromo-2-N-phenylquinazoline-2,4-diamine. InChIKey: MPGNABXYXOGUGH-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN4 |
|---|---|
| Molecular weight | 315.17 g/mol |
| IUPAC name | 6-bromo-2-N-phenylquinazoline-2,4-diamine |
| InChIKey | MPGNABXYXOGUGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC3=C(C=C(C=C3)Br)C(=N2)N |
Computed by PubChem (NCBI)