Products 169237-56-3

CAS 169237-56-3 is the registry number for 3-(Boc-NH)-pent-4-enoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (CAS 169237-56-3) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid. InChIKey: AQTGANYMYTZCKP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO4
Molecular weight215.25 g/mol
IUPAC name3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid
InChIKeyAQTGANYMYTZCKP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC(=O)O)C=C

Computed by PubChem (NCBI)