CAS 1692521-86-0 appears in our catalog under these names: 2-(3,4-Difluorophenyl)propanedinitrile, 95%, 2-(3,4-Difluorophenyl)propanedinitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 5g, 1g, 50mg, 0,5g.
2-(3,4-difluorophenyl)propanedinitrile (CAS 1692521-86-0) is a chemical compound with the molecular formula C9H4F2N2 and a molecular weight of 178.14 g/mol. IUPAC name: 2-(3,4-difluorophenyl)propanedinitrile. InChIKey: XDEWAVWVTZCCRD-UHFFFAOYSA-N.
| Molecular formula | C9H4F2N2 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)propanedinitrile |
| InChIKey | XDEWAVWVTZCCRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C#N)C#N)F)F |
Computed by PubChem (NCBI)