CAS 1805669-29-7 is the registry number for 4-(Cyanomethyl)-3,5-difluorobenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(cyanomethyl)-3,5-difluorobenzonitrile (CAS 1805669-29-7) is a chemical compound with the molecular formula C9H4F2N2 and a molecular weight of 178.14 g/mol. IUPAC name: 4-(cyanomethyl)-3,5-difluorobenzonitrile. InChIKey: BHZDFIHGPACJJC-UHFFFAOYSA-N.
| Molecular formula | C9H4F2N2 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 4-(cyanomethyl)-3,5-difluorobenzonitrile |
| InChIKey | BHZDFIHGPACJJC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CC#N)F)C#N |
Computed by PubChem (NCBI)