CAS 169280-16-4 is the registry number for N-Methoxy-N-methyl-2-phenyl-isobutyramide. Offered by: TRC. Available pack sizes: 100mg.
N-methoxy-N,2-dimethyl-2-phenylpropanamide (CAS 169280-16-4) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: N-methoxy-N,2-dimethyl-2-phenylpropanamide. InChIKey: FILAUFUTWXLFNL-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | N-methoxy-N,2-dimethyl-2-phenylpropanamide |
| InChIKey | FILAUFUTWXLFNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(=O)N(C)OC |
Computed by PubChem (NCBI)