CAS 1693-44-3 is the registry number for 2,2,4,4,6,6–hexamethyl–8,8–diphenylcyclotetrasiloxane. Offered by: GLPBio. Available pack sizes: 100g, 25g, 500g.
2,2,4,4,6,6-hexamethyl-8,8-diphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (CAS 1693-44-3) is a chemical compound with the molecular formula C18H28O4Si4 and a molecular weight of 420.8 g/mol. IUPAC name: 2,2,4,4,6,6-hexamethyl-8,8-diphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane. InChIKey: BOIFXPDTOHPTOD-UHFFFAOYSA-N.
| Molecular formula | C18H28O4Si4 |
|---|---|
| Molecular weight | 420.8 g/mol |
| IUPAC name | 2,2,4,4,6,6-hexamethyl-8,8-diphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| InChIKey | BOIFXPDTOHPTOD-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O1)(C)C)(C2=CC=CC=C2)C3=CC=CC=C3)(C)C)C |
Computed by PubChem (NCBI)