CAS 4657-20-9 is the registry number for Quadrosilan. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2,4,6,6,8-hexamethyl-4,8-diphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (CAS 4657-20-9) is a chemical compound with the molecular formula C18H28O4Si4 and a molecular weight of 420.8 g/mol. IUPAC name: 2,2,4,6,6,8-hexamethyl-4,8-diphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane. InChIKey: ZTQZMPQJXABFNC-UHFFFAOYSA-N.
| Molecular formula | C18H28O4Si4 |
|---|---|
| Molecular weight | 420.8 g/mol |
| IUPAC name | 2,2,4,6,6,8-hexamethyl-4,8-diphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| InChIKey | ZTQZMPQJXABFNC-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O1)(C)C2=CC=CC=C2)(C)C)(C)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)