Products 1693731-14-4
CAS 1693731-14-4 appears in our catalog under these names: CCT245232, CCT245232, 99.37%, CCT245232, 99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 10mg, 25mg, 5mg, 100 mg, 10mM/1mL, 10 mg, 25 mg.
N-[5-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-2-methylphenyl]-2-methylquinoline-6-carboxamide (CAS 1693731-14-4) is a chemical compound with the molecular formula C27H23N3O4 and a molecular weight of 453.5 g/mol. IUPAC name: N-[5-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-2-methylphenyl]-2-methylquinoline-6-carboxamide. InChIKey: RZQWMJAOUJLEAM-UHFFFAOYSA-N.
| Molecular formula | C27H23N3O4 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | N-[5-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-2-methylphenyl]-2-methylquinoline-6-carboxamide |
| InChIKey | RZQWMJAOUJLEAM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC3=C(C=C2)OCCO3)NC(=O)C4=CC5=C(C=C4)N=C(C=C5)C |
Computed by PubChem (NCBI)
Synonyms:
orb1687268, FJH