CAS 892243-35-5 appears in our catalog under these names: IPR–803, IPR-803, 98%, IPR-803/ 95%, IPR-803, IPR-803, 98.0%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 10 mg.
3-[[12-(azepan-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid (CAS 892243-35-5) is a chemical compound with the molecular formula C27H23N3O4 and a molecular weight of 453.5 g/mol. IUPAC name: 3-[[12-(azepan-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid. InChIKey: UAEULQWANHYLGJ-UHFFFAOYSA-N.
| Molecular formula | C27H23N3O4 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | 3-[[12-(azepan-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid |
| InChIKey | UAEULQWANHYLGJ-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)C2=CC(=C3C4=C(C5=CC=CC=C5C3=O)ON=C24)NC6=CC=CC(=C6)C(=O)O |
Computed by PubChem (NCBI)